C13H18BrN5 — CID 102637612
N-(2-bromocyclohexyl)-N,3-dimethyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 102637612) has the molecular formula C13H18BrN5 and a molecular weight of 324.23 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-N,3-dimethyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-(2-bromocyclohexyl)-N,3-dimethyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 102637612 |
| Molecular Formula | C13H18BrN5 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-(2-bromocyclohexyl)-N,3-dimethyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | Cc1nnc2c(N(C)C3CCCCC3Br)nccn12 |
| InChI | InChI=1S/C13H18BrN5/c1-9-16-17-13-12(15-7-8-19(9)13)18(2)11-6-4-3-5-10(11)14/h7-8,10-11H,3-6H2,1-2H3 |
| InChIKey | DGVMACKGNJVIFF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|