C10H14N2O3S — CID 10263774
3-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide (PubChem CID 10263774) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide.
| Compound Name | 3-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 10263774 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-(hydroxymethyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CNC(CO)C2 |
| InChI | InChI=1S/C10H14N2O3S/c11-16(14,15)10-2-1-7-3-9(6-13)12-5-8(7)4-10/h1-2,4,9,12-13H,3,5-6H2,(H2,11,14,15) |
| InChIKey | NCMRRZQCMRUVIY-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |