C16H18ClNOS — CID 102638117
N-(2-chlorocyclohexyl)-N-methyl-1-benzothiophene-2-carboxamide (PubChem CID 102638117) has the molecular formula C16H18ClNOS and a molecular weight of 307.85 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-N-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-chlorocyclohexyl)-N-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 102638117 |
| Molecular Formula | C16H18ClNOS |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(2-chlorocyclohexyl)-N-methyl-1-benzothiophene-2-carboxamide |
| SMILES | CN(C(=O)c1cc2ccccc2s1)C1CCCCC1Cl |
| InChI | InChI=1S/C16H18ClNOS/c1-18(13-8-4-3-7-12(13)17)16(19)15-10-11-6-2-5-9-14(11)20-15/h2,5-6,9-10,12-13H,3-4,7-8H2,1H3 |
| InChIKey | DAAPGIBSLYRYDO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|