C17H24ClNO — CID 102638215
N-(2-chlorocyclohexyl)-N-methyl-3-(3-methylphenyl)propanamide (PubChem CID 102638215) has the molecular formula C17H24ClNO and a molecular weight of 293.84 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-N-methyl-3-(3-methylphenyl)propanamide.
| Compound Name | N-(2-chlorocyclohexyl)-N-methyl-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 102638215 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(2-chlorocyclohexyl)-N-methyl-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(CCC(=O)N(C)C2CCCCC2Cl)c1 |
| InChI | InChI=1S/C17H24ClNO/c1-13-6-5-7-14(12-13)10-11-17(20)19(2)16-9-4-3-8-15(16)18/h5-7,12,15-16H,3-4,8-11H2,1-2H3 |
| InChIKey | HRVKOADCVNVENJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|