C12H24BrNO2S — CID 102638590
N-(2-bromocyclohexyl)-N,3-dimethylbutane-1-sulfonamide (PubChem CID 102638590) has the molecular formula C12H24BrNO2S and a molecular weight of 326.30 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-N,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(2-bromocyclohexyl)-N,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 102638590 |
| Molecular Formula | C12H24BrNO2S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-(2-bromocyclohexyl)-N,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)CCS(=O)(=O)N(C)C1CCCCC1Br |
| InChI | InChI=1S/C12H24BrNO2S/c1-10(2)8-9-17(15,16)14(3)12-7-5-4-6-11(12)13/h10-12H,4-9H2,1-3H3 |
| InChIKey | GKNXCTQKVBSZRS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|