C11H18ClN3O2S — CID 102638692
N-(2-chlorocyclohexyl)-N,2-dimethylpyrazole-3-sulfonamide (PubChem CID 102638692) has the molecular formula C11H18ClN3O2S and a molecular weight of 291.80 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-N,2-dimethylpyrazole-3-sulfonamide.
| Compound Name | N-(2-chlorocyclohexyl)-N,2-dimethylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 102638692 |
| Molecular Formula | C11H18ClN3O2S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-(2-chlorocyclohexyl)-N,2-dimethylpyrazole-3-sulfonamide |
| SMILES | CN(C1CCCCC1Cl)S(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C11H18ClN3O2S/c1-14-11(7-8-13-14)18(16,17)15(2)10-6-4-3-5-9(10)12/h7-10H,3-6H2,1-2H3 |
| InChIKey | AKWHAHIXVDAPSF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|