C17H20N2O2 — CID 102638918
ethyl 2-methyl-2-[(1-phenylpyrazol-4-yl)methyl]but-3-enoate (PubChem CID 102638918) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is ethyl 2-methyl-2-[(1-phenylpyrazol-4-yl)methyl]but-3-enoate.
| Compound Name | ethyl 2-methyl-2-[(1-phenylpyrazol-4-yl)methyl]but-3-enoate |
|---|---|
| PubChem CID | 102638918 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | ethyl 2-methyl-2-[(1-phenylpyrazol-4-yl)methyl]but-3-enoate |
| SMILES | C=CC(C)(Cc1cnn(-c2ccccc2)c1)C(=O)OCC |
| InChI | InChI=1S/C17H20N2O2/c1-4-17(3,16(20)21-5-2)11-14-12-18-19(13-14)15-9-7-6-8-10-15/h4,6-10,12-13H,1,5,11H2,2-3H3 |
| InChIKey | KVYHVWCEHXRMGD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|