C12H23NO — CID 102640364
2-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylbut-3-en-1-amine (PubChem CID 102640364) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylbut-3-en-1-amine.
| Compound Name | 2-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 102640364 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-[(5,5-dimethyloxolan-2-yl)methyl]-2-methylbut-3-en-1-amine |
| SMILES | C=CC(C)(CN)CC1CCC(C)(C)O1 |
| InChI | InChI=1S/C12H23NO/c1-5-12(4,9-13)8-10-6-7-11(2,3)14-10/h5,10H,1,6-9,13H2,2-4H3 |
| InChIKey | PELSHLAJFCYVIK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|