C13H17F2N — CID 102640578
2-[(2,4-difluorophenyl)methyl]-N,2-dimethylbut-3-en-1-amine (PubChem CID 102640578) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methyl]-N,2-dimethylbut-3-en-1-amine.
| Compound Name | 2-[(2,4-difluorophenyl)methyl]-N,2-dimethylbut-3-en-1-amine |
|---|---|
| PubChem CID | 102640578 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methyl]-N,2-dimethylbut-3-en-1-amine |
| SMILES | C=CC(C)(CNC)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C13H17F2N/c1-4-13(2,9-16-3)8-10-5-6-11(14)7-12(10)15/h4-7,16H,1,8-9H2,2-3H3 |
| InChIKey | LRURMMAZBMGNKD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|