C16H11NO2 — CID 10264062
(1aS,2R,7bS)-2-phenyl-1a,2-dihydrooxireno[2,3-c]chromene-7b-carbonitrile (PubChem CID 10264062) has the molecular formula C16H11NO2 and a molecular weight of 249.27 g/mol. Its IUPAC name is (1aS,2R,7bS)-2-phenyl-1a,2-dihydrooxireno[2,3-c]chromene-7b-carbonitrile.
| Compound Name | (1aS,2R,7bS)-2-phenyl-1a,2-dihydrooxireno[2,3-c]chromene-7b-carbonitrile |
|---|---|
| PubChem CID | 10264062 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (1aS,2R,7bS)-2-phenyl-1a,2-dihydrooxireno[2,3-c]chromene-7b-carbonitrile |
| SMILES | N#C[C@]12O[C@H]1[C@@H](c1ccccc1)Oc1ccccc12 |
| InChI | InChI=1S/C16H11NO2/c17-10-16-12-8-4-5-9-13(12)18-14(15(16)19-16)11-6-2-1-3-7-11/h1-9,14-15H/t14-,15+,16-/m1/s1 |
| InChIKey | TWDCVGWNSFOEFU-OWCLPIDISA-N |
| XLogP | 2.94 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|