C11H20F3NS — CID 102641024
2-methyl-N-propan-2-yl-2-[2-(trifluoromethylsulfanyl)ethyl]but-3-en-1-amine (PubChem CID 102641024) has the molecular formula C11H20F3NS and a molecular weight of 255.35 g/mol. Its IUPAC name is 2-methyl-N-propan-2-yl-2-[2-(trifluoromethylsulfanyl)ethyl]but-3-en-1-amine.
| Compound Name | 2-methyl-N-propan-2-yl-2-[2-(trifluoromethylsulfanyl)ethyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 102641024 |
| Molecular Formula | C11H20F3NS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-methyl-N-propan-2-yl-2-[2-(trifluoromethylsulfanyl)ethyl]but-3-en-1-amine |
| SMILES | C=CC(C)(CCSC(F)(F)F)CNC(C)C |
| InChI | InChI=1S/C11H20F3NS/c1-5-10(4,8-15-9(2)3)6-7-16-11(12,13)14/h5,9,15H,1,6-8H2,2-4H3 |
| InChIKey | TVNQQGKOBNNZGB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|