C13H24F3NO — CID 102641092
2-ethenyl-2-methyl-N-propan-2-yl-5-(2,2,2-trifluoroethoxy)pentan-1-amine (PubChem CID 102641092) has the molecular formula C13H24F3NO and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-ethenyl-2-methyl-N-propan-2-yl-5-(2,2,2-trifluoroethoxy)pentan-1-amine.
| Compound Name | 2-ethenyl-2-methyl-N-propan-2-yl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
|---|---|
| PubChem CID | 102641092 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-ethenyl-2-methyl-N-propan-2-yl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
| SMILES | C=CC(C)(CCCOCC(F)(F)F)CNC(C)C |
| InChI | InChI=1S/C13H24F3NO/c1-5-12(4,9-17-11(2)3)7-6-8-18-10-13(14,15)16/h5,11,17H,1,6-10H2,2-4H3 |
| InChIKey | XCKCWECKNQCSTJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|