C13H14N4O3 — CID 102642508
1-(oxolan-3-ylmethyl)-5-pyridin-3-yltriazole-4-carboxylic acid (PubChem CID 102642508) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-(oxolan-3-ylmethyl)-5-pyridin-3-yltriazole-4-carboxylic acid.
| Compound Name | 1-(oxolan-3-ylmethyl)-5-pyridin-3-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642508 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-(oxolan-3-ylmethyl)-5-pyridin-3-yltriazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(CC2CCOC2)c1-c1cccnc1 |
| InChI | InChI=1S/C13H14N4O3/c18-13(19)11-12(10-2-1-4-14-6-10)17(16-15-11)7-9-3-5-20-8-9/h1-2,4,6,9H,3,5,7-8H2,(H,18,19) |
| InChIKey | RRPXSONAGZFIEJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |