About 2-amino-1,4-dihydroxyanthracene-9,10-dione
2-amino-1,4-dihydroxyanthracene-9,10-dione (PubChem CID 10264328) has the molecular formula C14H9NO4
and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-amino-1,4-dihydroxyanthracene-9,10-dione.
Molecular Properties
| Compound Name | 2-amino-1,4-dihydroxyanthracene-9,10-dione |
| PubChem CID | 10264328 |
| Molecular Formula | C14H9NO4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-amino-1,4-dihydroxyanthracene-9,10-dione |
| SMILES | Nc1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H9NO4/c15-8-5-9(16)10-11(14(8)19)13(18)7-4-2-1-3-6(7)12(10)17/h1-5,16,19H,15H2 |
| InChIKey | RVKNAJFYQBIAHS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1,4-dihydroxyanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,4-dihydroxyanthracene-9,10-dione?
The IUPAC name of 2-amino-1,4-dihydroxyanthracene-9,10-dione (CID 10264328) is 2-amino-1,4-dihydroxyanthracene-9,10-dione.
What is the SMILES notation for 2-amino-1,4-dihydroxyanthracene-9,10-dione?
The canonical SMILES for 2-amino-1,4-dihydroxyanthracene-9,10-dione is Nc1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O.
What is the InChIKey of 2-amino-1,4-dihydroxyanthracene-9,10-dione?
The InChIKey is RVKNAJFYQBIAHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO4/c15-8-5-9(16)10-11(14(8)19)13(18)7-4-2-1-3-6(7)12(10)17/h1-5,16,19H,15H2.
What are the key properties of 2-amino-1,4-dihydroxyanthracene-9,10-dione?
2-amino-1,4-dihydroxyanthracene-9,10-dione has a molecular weight of 255.23 g/mol, XLogP of 1.46, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,4-dihydroxyanthracene-9,10-dione is sourced from PubChem (CID 10264328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).