C13H13FN4O3 — CID 102644290
1-(2-acetamidoethyl)-5-(4-fluorophenyl)triazole-4-carboxylic acid (PubChem CID 102644290) has the molecular formula C13H13FN4O3 and a molecular weight of 292.27 g/mol. Its IUPAC name is 1-(2-acetamidoethyl)-5-(4-fluorophenyl)triazole-4-carboxylic acid.
| Compound Name | 1-(2-acetamidoethyl)-5-(4-fluorophenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644290 |
| Molecular Formula | C13H13FN4O3 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(2-acetamidoethyl)-5-(4-fluorophenyl)triazole-4-carboxylic acid |
| SMILES | CC(=O)NCCn1nnc(C(=O)O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H13FN4O3/c1-8(19)15-6-7-18-12(11(13(20)21)16-17-18)9-2-4-10(14)5-3-9/h2-5H,6-7H2,1H3,(H,15,19)(H,20,21) |
| InChIKey | SQIQNSMIJZHMMB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |