C16H19NO2 — CID 10264444
(3aR,9bR)-6-methoxy-3-prop-2-enyl-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-one (PubChem CID 10264444) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3aR,9bR)-6-methoxy-3-prop-2-enyl-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-one.
| Compound Name | (3aR,9bR)-6-methoxy-3-prop-2-enyl-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-one |
|---|---|
| PubChem CID | 10264444 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (3aR,9bR)-6-methoxy-3-prop-2-enyl-3a,4,5,9b-tetrahydro-1H-benzo[e]indol-2-one |
| SMILES | C=CCN1C(=O)C[C@@H]2c3cccc(OC)c3CC[C@H]21 |
| InChI | InChI=1S/C16H19NO2/c1-3-9-17-14-8-7-12-11(13(14)10-16(17)18)5-4-6-15(12)19-2/h3-6,13-14H,1,7-10H2,2H3/t13-,14-/m1/s1 |
| InChIKey | IHFIVGNQYANVHW-ZIAGYGMSSA-N |
| XLogP | 2.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|