C12H16F2N4O3 — CID 102644445
5-(difluoromethyl)-1-(1-oxo-1-piperidin-1-ylpropan-2-yl)triazole-4-carboxylic acid (PubChem CID 102644445) has the molecular formula C12H16F2N4O3 and a molecular weight of 302.28 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-(1-oxo-1-piperidin-1-ylpropan-2-yl)triazole-4-carboxylic acid.
| Compound Name | 5-(difluoromethyl)-1-(1-oxo-1-piperidin-1-ylpropan-2-yl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644445 |
| Molecular Formula | C12H16F2N4O3 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 5-(difluoromethyl)-1-(1-oxo-1-piperidin-1-ylpropan-2-yl)triazole-4-carboxylic acid |
| SMILES | CC(C(=O)N1CCCCC1)n1nnc(C(=O)O)c1C(F)F |
| InChI | InChI=1S/C12H16F2N4O3/c1-7(11(19)17-5-3-2-4-6-17)18-9(10(13)14)8(12(20)21)15-16-18/h7,10H,2-6H2,1H3,(H,20,21) |
| InChIKey | IEWQTUNHPXDOGQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |