C13H17N3O4 — CID 102646144
methyl 5-(2-methoxyethyl)-1-[(5-methylfuran-2-yl)methyl]triazole-4-carboxylate (PubChem CID 102646144) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is methyl 5-(2-methoxyethyl)-1-[(5-methylfuran-2-yl)methyl]triazole-4-carboxylate.
| Compound Name | methyl 5-(2-methoxyethyl)-1-[(5-methylfuran-2-yl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 102646144 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | methyl 5-(2-methoxyethyl)-1-[(5-methylfuran-2-yl)methyl]triazole-4-carboxylate |
| SMILES | COCCc1c(C(=O)OC)nnn1Cc1ccc(C)o1 |
| InChI | InChI=1S/C13H17N3O4/c1-9-4-5-10(20-9)8-16-11(6-7-18-2)12(14-15-16)13(17)19-3/h4-5H,6-8H2,1-3H3 |
| InChIKey | ZARFDSSVAYVTMD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |