C15H24O2 — CID 102646908
3,4-dihydro-2H-pyran-6-yl-(4-propylcyclohexyl)methanone (PubChem CID 102646908) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-6-yl-(4-propylcyclohexyl)methanone.
| Compound Name | 3,4-dihydro-2H-pyran-6-yl-(4-propylcyclohexyl)methanone |
|---|---|
| PubChem CID | 102646908 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3,4-dihydro-2H-pyran-6-yl-(4-propylcyclohexyl)methanone |
| SMILES | CCCC1CCC(C(=O)C2=CCCCO2)CC1 |
| InChI | InChI=1S/C15H24O2/c1-2-5-12-7-9-13(10-8-12)15(16)14-6-3-4-11-17-14/h6,12-13H,2-5,7-11H2,1H3 |
| InChIKey | JRPFJHWOJRKRPE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |