About 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine
1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine (PubChem CID 102647132) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine.
Analyze 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine?
The IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine (CID 102647132) is 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine?
The canonical SMILES for 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine is CC(C)C(N)C1=CCCCO1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine?
The InChIKey is BEMPALMBBFLMDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-7(2)9(10)8-5-3-4-6-11-8/h5,7,9H,3-4,6,10H2,1-2H3.
What are the key properties of 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine?
1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine has a molecular weight of 155.24 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-amine is sourced from PubChem (CID 102647132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).