About 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine
1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine (PubChem CID 102647216) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine |
| PubChem CID | 102647216 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine |
| SMILES | CCCC(NC)C1=CCCCO1 |
| InChI | InChI=1S/C10H19NO/c1-3-6-9(11-2)10-7-4-5-8-12-10/h7,9,11H,3-6,8H2,1-2H3 |
| InChIKey | ODCFSQYXUQAEMN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine?
The IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine (CID 102647216) is 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine?
The canonical SMILES for 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine is CCCC(NC)C1=CCCCO1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine?
The InChIKey is ODCFSQYXUQAEMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-3-6-9(11-2)10-7-4-5-8-12-10/h7,9,11H,3-6,8H2,1-2H3.
What are the key properties of 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine?
1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine has a molecular weight of 169.27 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyran-6-yl)-N-methylbutan-1-amine is sourced from PubChem (CID 102647216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).