About 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine
1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine (PubChem CID 102647277) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine |
| PubChem CID | 102647277 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine |
| SMILES | CNC(CCC(C)C)C1=CCCCO1 |
| InChI | InChI=1S/C12H23NO/c1-10(2)7-8-11(13-3)12-6-4-5-9-14-12/h6,10-11,13H,4-5,7-9H2,1-3H3 |
| InChIKey | RZAKPJQXXRZRCS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine?
The IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine (CID 102647277) is 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine?
The canonical SMILES for 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine is CNC(CCC(C)C)C1=CCCCO1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine?
The InChIKey is RZAKPJQXXRZRCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-10(2)7-8-11(13-3)12-6-4-5-9-14-12/h6,10-11,13H,4-5,7-9H2,1-3H3.
What are the key properties of 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine?
1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine has a molecular weight of 197.32 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyran-6-yl)-N,4-dimethylpentan-1-amine is sourced from PubChem (CID 102647277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).