About N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine
N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine (PubChem CID 102647515) has the molecular formula C12H23NOS
and a molecular weight of 229.39 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine |
| PubChem CID | 102647515 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine |
| SMILES | CCCNC(CSCC)C1=CCCCO1 |
| InChI | InChI=1S/C12H23NOS/c1-3-8-13-11(10-15-4-2)12-7-5-6-9-14-12/h7,11,13H,3-6,8-10H2,1-2H3 |
| InChIKey | WLONCKMHVZTXJS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine?
The IUPAC name of N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine (CID 102647515) is N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine.
What is the SMILES notation for N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine?
The canonical SMILES for N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine is CCCNC(CSCC)C1=CCCCO1.
What is the InChIKey of N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine?
The InChIKey is WLONCKMHVZTXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NOS/c1-3-8-13-11(10-15-4-2)12-7-5-6-9-14-12/h7,11,13H,3-6,8-10H2,1-2H3.
What are the key properties of N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine?
N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine has a molecular weight of 229.39 g/mol, XLogP of 2.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylsulfanylethyl]propan-1-amine is sourced from PubChem (CID 102647515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).