C14H25NO — CID 102647577
3,4-dihydro-2H-pyran-6-yl-(4-ethylcyclohexyl)methanamine (PubChem CID 102647577) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-6-yl-(4-ethylcyclohexyl)methanamine.
| Compound Name | 3,4-dihydro-2H-pyran-6-yl-(4-ethylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 102647577 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 3,4-dihydro-2H-pyran-6-yl-(4-ethylcyclohexyl)methanamine |
| SMILES | CCC1CCC(C(N)C2=CCCCO2)CC1 |
| InChI | InChI=1S/C14H25NO/c1-2-11-6-8-12(9-7-11)14(15)13-5-3-4-10-16-13/h5,11-12,14H,2-4,6-10,15H2,1H3 |
| InChIKey | OHMBMTHVNXNHPT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |