C13H23NO — CID 102647585
cycloheptyl(3,4-dihydro-2H-pyran-6-yl)methanamine (PubChem CID 102647585) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is cycloheptyl(3,4-dihydro-2H-pyran-6-yl)methanamine.
| Compound Name | cycloheptyl(3,4-dihydro-2H-pyran-6-yl)methanamine |
|---|---|
| PubChem CID | 102647585 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | cycloheptyl(3,4-dihydro-2H-pyran-6-yl)methanamine |
| SMILES | NC(C1=CCCCO1)C1CCCCCC1 |
| InChI | InChI=1S/C13H23NO/c14-13(12-9-5-6-10-15-12)11-7-3-1-2-4-8-11/h9,11,13H,1-8,10,14H2 |
| InChIKey | BXHGGIFDPRCBTI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |