About N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine
N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine (PubChem CID 102647626) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine |
| PubChem CID | 102647626 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCO1)C1CC1C |
| InChI | InChI=1S/C13H23NO/c1-3-7-14-13(11-9-10(11)2)12-6-4-5-8-15-12/h6,10-11,13-14H,3-5,7-9H2,1-2H3 |
| InChIKey | NCWASTVLDQKZKD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine?
The IUPAC name of N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine (CID 102647626) is N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine.
What is the SMILES notation for N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine?
The canonical SMILES for N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine is CCCNC(C1=CCCCO1)C1CC1C.
What is the InChIKey of N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine?
The InChIKey is NCWASTVLDQKZKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO/c1-3-7-14-13(11-9-10(11)2)12-6-4-5-8-15-12/h6,10-11,13-14H,3-5,7-9H2,1-2H3.
What are the key properties of N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine?
N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine has a molecular weight of 209.33 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,4-dihydro-2H-pyran-6-yl-(2-methylcyclopropyl)methyl]propan-1-amine is sourced from PubChem (CID 102647626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).