About 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid
2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid (PubChem CID 10264764) has the molecular formula C12H12N2O5
and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid |
| PubChem CID | 10264764 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid |
| SMILES | NC(Cc1c(-c2ccccc2O)o[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C12H12N2O5/c13-8(12(17)18)5-7-10(19-14-11(7)16)6-3-1-2-4-9(6)15/h1-4,8,15H,5,13H2,(H,14,16)(H,17,18) |
| InChIKey | UMZPAVQEGRCODP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
The IUPAC name of 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid (CID 10264764) is 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
The canonical SMILES for 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid is NC(Cc1c(-c2ccccc2O)o[nH]c1=O)C(=O)O.
What is the InChIKey of 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
The InChIKey is UMZPAVQEGRCODP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O5/c13-8(12(17)18)5-7-10(19-14-11(7)16)6-3-1-2-4-9(6)15/h1-4,8,15H,5,13H2,(H,14,16)(H,17,18).
What are the key properties of 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid?
2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid has a molecular weight of 264.24 g/mol, XLogP of 0.29, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[5-(2-hydroxyphenyl)-3-oxo-1,2-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 10264764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).