About 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine
1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine (PubChem CID 102648096) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine |
| PubChem CID | 102648096 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)(OC)C(NC)C1=CCCCO1 |
| InChI | InChI=1S/C12H23NO2/c1-5-12(2,14-4)11(13-3)10-8-6-7-9-15-10/h8,11,13H,5-7,9H2,1-4H3 |
| InChIKey | GPEBTTNUFUYGOO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine?
The IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine (CID 102648096) is 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine?
The canonical SMILES for 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine is CCC(C)(OC)C(NC)C1=CCCCO1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine?
The InChIKey is GPEBTTNUFUYGOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-5-12(2,14-4)11(13-3)10-8-6-7-9-15-10/h8,11,13H,5-7,9H2,1-4H3.
What are the key properties of 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine?
1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine has a molecular weight of 213.32 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-N,2-dimethylbutan-1-amine is sourced from PubChem (CID 102648096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).