About 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine
2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine (PubChem CID 102648240) has the molecular formula C7H12FNO
and a molecular weight of 145.18 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine |
| PubChem CID | 102648240 |
| Molecular Formula | C7H12FNO |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine |
| SMILES | NCC(F)C1=CCCCO1 |
| InChI | InChI=1S/C7H12FNO/c8-6(5-9)7-3-1-2-4-10-7/h3,6H,1-2,4-5,9H2 |
| InChIKey | YBQFWBPNUCFXFJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine?
The IUPAC name of 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine (CID 102648240) is 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine.
What is the SMILES notation for 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine?
The canonical SMILES for 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine is NCC(F)C1=CCCCO1.
What is the InChIKey of 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine?
The InChIKey is YBQFWBPNUCFXFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FNO/c8-6(5-9)7-3-1-2-4-10-7/h3,6H,1-2,4-5,9H2.
What are the key properties of 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine?
2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine has a molecular weight of 145.18 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-pyran-6-yl)-2-fluoroethanamine is sourced from PubChem (CID 102648240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).