About 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine
3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine (PubChem CID 102648246) has the molecular formula C9H14FNO
and a molecular weight of 171.21 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine |
| PubChem CID | 102648246 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine |
| SMILES | FC1(C2=CCCCO2)CCNC1 |
| InChI | InChI=1S/C9H14FNO/c10-9(4-5-11-7-9)8-3-1-2-6-12-8/h3,11H,1-2,4-7H2 |
| InChIKey | OBQVINCDJLMVOX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine?
The IUPAC name of 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine (CID 102648246) is 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine.
What is the SMILES notation for 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine?
The canonical SMILES for 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine is FC1(C2=CCCCO2)CCNC1.
What is the InChIKey of 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine?
The InChIKey is OBQVINCDJLMVOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FNO/c10-9(4-5-11-7-9)8-3-1-2-6-12-8/h3,11H,1-2,4-7H2.
What are the key properties of 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine?
3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine has a molecular weight of 171.21 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-pyran-6-yl)-3-fluoropyrrolidine is sourced from PubChem (CID 102648246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).