About 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane
4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane (PubChem CID 102648259) has the molecular formula C11H18FNO
and a molecular weight of 199.27 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane.
Molecular Properties
| Compound Name | 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane |
| PubChem CID | 102648259 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane |
| SMILES | FC1(C2=CCCCO2)CCCNCC1 |
| InChI | InChI=1S/C11H18FNO/c12-11(5-3-7-13-8-6-11)10-4-1-2-9-14-10/h4,13H,1-3,5-9H2 |
| InChIKey | JLXUKGQZCGOFSR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane?
The IUPAC name of 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane (CID 102648259) is 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane.
What is the SMILES notation for 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane?
The canonical SMILES for 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane is FC1(C2=CCCCO2)CCCNCC1.
What is the InChIKey of 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane?
The InChIKey is JLXUKGQZCGOFSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FNO/c12-11(5-3-7-13-8-6-11)10-4-1-2-9-14-10/h4,13H,1-3,5-9H2.
What are the key properties of 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane?
4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane has a molecular weight of 199.27 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-2H-pyran-6-yl)-4-fluoroazepane is sourced from PubChem (CID 102648259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).