C12H21NO2 — CID 102648305
1-(3,4-dihydro-2H-pyran-6-yl)-4-(propan-2-ylamino)butan-1-one (PubChem CID 102648305) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-4-(propan-2-ylamino)butan-1-one.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-4-(propan-2-ylamino)butan-1-one |
|---|---|
| PubChem CID | 102648305 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-4-(propan-2-ylamino)butan-1-one |
| SMILES | CC(C)NCCCC(=O)C1=CCCCO1 |
| InChI | InChI=1S/C12H21NO2/c1-10(2)13-8-5-6-11(14)12-7-3-4-9-15-12/h7,10,13H,3-6,8-9H2,1-2H3 |
| InChIKey | DQKKNSIHVLJKKO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|