About (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone
(1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone (PubChem CID 102648307) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone.
Molecular Properties
| Compound Name | (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone |
| PubChem CID | 102648307 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone |
| SMILES | NC1(C(=O)C2=CCCCO2)CCCC1 |
| InChI | InChI=1S/C11H17NO2/c12-11(6-2-3-7-11)10(13)9-5-1-4-8-14-9/h5H,1-4,6-8,12H2 |
| InChIKey | CKMGZBZHIGUCAH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone?
The IUPAC name of (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone (CID 102648307) is (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone.
What is the SMILES notation for (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone?
The canonical SMILES for (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone is NC1(C(=O)C2=CCCCO2)CCCC1.
What is the InChIKey of (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone?
The InChIKey is CKMGZBZHIGUCAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c12-11(6-2-3-7-11)10(13)9-5-1-4-8-14-9/h5H,1-4,6-8,12H2.
What are the key properties of (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone?
(1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone has a molecular weight of 195.26 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-aminocyclopentyl)-(3,4-dihydro-2H-pyran-6-yl)methanone is sourced from PubChem (CID 102648307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).