C10H15NO3 — CID 102648319
3,4-dihydro-2H-pyran-6-yl(morpholin-2-yl)methanone (PubChem CID 102648319) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-6-yl(morpholin-2-yl)methanone.
| Compound Name | 3,4-dihydro-2H-pyran-6-yl(morpholin-2-yl)methanone |
|---|---|
| PubChem CID | 102648319 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 3,4-dihydro-2H-pyran-6-yl(morpholin-2-yl)methanone |
| SMILES | O=C(C1=CCCCO1)C1CNCCO1 |
| InChI | InChI=1S/C10H15NO3/c12-10(8-3-1-2-5-13-8)9-7-11-4-6-14-9/h3,9,11H,1-2,4-7H2 |
| InChIKey | MWSZVZOBOBTJDH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |