About 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one
5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one (PubChem CID 102648356) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one.
Molecular Properties
| Compound Name | 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one |
| PubChem CID | 102648356 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one |
| SMILES | NCCCCC(=O)C1=CCCCO1 |
| InChI | InChI=1S/C10H17NO2/c11-7-3-1-5-9(12)10-6-2-4-8-13-10/h6H,1-5,7-8,11H2 |
| InChIKey | CADAELUTYQRICZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one?
The IUPAC name of 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one (CID 102648356) is 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one.
What is the SMILES notation for 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one?
The canonical SMILES for 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one is NCCCCC(=O)C1=CCCCO1.
What is the InChIKey of 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one?
The InChIKey is CADAELUTYQRICZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c11-7-3-1-5-9(12)10-6-2-4-8-13-10/h6H,1-5,7-8,11H2.
What are the key properties of 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one?
5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one has a molecular weight of 183.25 g/mol, XLogP of 1.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(3,4-dihydro-2H-pyran-6-yl)pentan-1-one is sourced from PubChem (CID 102648356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).