About 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one
6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one (PubChem CID 102648378) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one.
Molecular Properties
| Compound Name | 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one |
| PubChem CID | 102648378 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one |
| SMILES | CCC(CCN)CCC(=O)C1=CCCCO1 |
| InChI | InChI=1S/C13H23NO2/c1-2-11(8-9-14)6-7-12(15)13-5-3-4-10-16-13/h5,11H,2-4,6-10,14H2,1H3 |
| InChIKey | PCVZBLJVEPNHOR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one?
The IUPAC name of 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one (CID 102648378) is 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one.
What is the SMILES notation for 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one?
The canonical SMILES for 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one is CCC(CCN)CCC(=O)C1=CCCCO1.
What is the InChIKey of 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one?
The InChIKey is PCVZBLJVEPNHOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-2-11(8-9-14)6-7-12(15)13-5-3-4-10-16-13/h5,11H,2-4,6-10,14H2,1H3.
What are the key properties of 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one?
6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one has a molecular weight of 225.33 g/mol, XLogP of 2.40, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-ethylhexan-1-one is sourced from PubChem (CID 102648378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).