C10H17NO3 — CID 102648424
1-(3,4-dihydro-2H-pyran-6-yl)-2-(2-methoxyethylamino)ethanone (PubChem CID 102648424) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-2-(2-methoxyethylamino)ethanone.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-2-(2-methoxyethylamino)ethanone |
|---|---|
| PubChem CID | 102648424 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-2-(2-methoxyethylamino)ethanone |
| SMILES | COCCNCC(=O)C1=CCCCO1 |
| InChI | InChI=1S/C10H17NO3/c1-13-7-5-11-8-9(12)10-4-2-3-6-14-10/h4,11H,2-3,5-8H2,1H3 |
| InChIKey | IOFKHRZUXSJEPL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|