About 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one
3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one (PubChem CID 102648477) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one |
| PubChem CID | 102648477 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one |
| SMILES | CC(C)C(N)CC(=O)C1=CCCCO1 |
| InChI | InChI=1S/C11H19NO2/c1-8(2)9(12)7-10(13)11-5-3-4-6-14-11/h5,8-9H,3-4,6-7,12H2,1-2H3 |
| InChIKey | NKMJREOVZNEPHM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one?
The IUPAC name of 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one (CID 102648477) is 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one.
What is the SMILES notation for 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one?
The canonical SMILES for 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one is CC(C)C(N)CC(=O)C1=CCCCO1.
What is the InChIKey of 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one?
The InChIKey is NKMJREOVZNEPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-8(2)9(12)7-10(13)11-5-3-4-6-14-11/h5,8-9H,3-4,6-7,12H2,1-2H3.
What are the key properties of 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one?
3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one has a molecular weight of 197.28 g/mol, XLogP of 1.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(3,4-dihydro-2H-pyran-6-yl)-4-methylpentan-1-one is sourced from PubChem (CID 102648477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).