C18H35N — CID 10264855
1-(3,3-diethyl-1,5,5-trimethylcyclohexyl)piperidine (PubChem CID 10264855) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is 1-(3,3-diethyl-1,5,5-trimethylcyclohexyl)piperidine.
| Compound Name | 1-(3,3-diethyl-1,5,5-trimethylcyclohexyl)piperidine |
|---|---|
| PubChem CID | 10264855 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | 1-(3,3-diethyl-1,5,5-trimethylcyclohexyl)piperidine |
| SMILES | CCC1(CC)CC(C)(C)CC(C)(N2CCCCC2)C1 |
| InChI | InChI=1S/C18H35N/c1-6-18(7-2)14-16(3,4)13-17(5,15-18)19-11-9-8-10-12-19/h6-15H2,1-5H3 |
| InChIKey | BJOGJNUXKSJDOZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |