C13H15NO2 — CID 102648686
1-(3,4-dihydro-2H-pyran-6-yl)-3-pyridin-3-ylpropan-1-one (PubChem CID 102648686) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-3-pyridin-3-ylpropan-1-one.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-3-pyridin-3-ylpropan-1-one |
|---|---|
| PubChem CID | 102648686 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-3-pyridin-3-ylpropan-1-one |
| SMILES | O=C(CCc1cccnc1)C1=CCCCO1 |
| InChI | InChI=1S/C13H15NO2/c15-12(13-5-1-2-9-16-13)7-6-11-4-3-8-14-10-11/h3-5,8,10H,1-2,6-7,9H2 |
| InChIKey | RNWPCOBABMLKRG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |