C13H23NO — CID 102648982
2-cyclohexyl-1-(3,4-dihydro-2H-pyran-6-yl)ethanamine (PubChem CID 102648982) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2-cyclohexyl-1-(3,4-dihydro-2H-pyran-6-yl)ethanamine.
| Compound Name | 2-cyclohexyl-1-(3,4-dihydro-2H-pyran-6-yl)ethanamine |
|---|---|
| PubChem CID | 102648982 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-cyclohexyl-1-(3,4-dihydro-2H-pyran-6-yl)ethanamine |
| SMILES | NC(CC1CCCCC1)C1=CCCCO1 |
| InChI | InChI=1S/C13H23NO/c14-12(13-8-4-5-9-15-13)10-11-6-2-1-3-7-11/h8,11-12H,1-7,9-10,14H2 |
| InChIKey | XQWNMYSZSOLAFQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |