C15H20INO — CID 102649008
N-[3,4-dihydro-2H-pyran-6-yl-(2-iodophenyl)methyl]propan-1-amine (PubChem CID 102649008) has the molecular formula C15H20INO and a molecular weight of 357.24 g/mol. Its IUPAC name is N-[3,4-dihydro-2H-pyran-6-yl-(2-iodophenyl)methyl]propan-1-amine.
| Compound Name | N-[3,4-dihydro-2H-pyran-6-yl-(2-iodophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 102649008 |
| Molecular Formula | C15H20INO |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-[3,4-dihydro-2H-pyran-6-yl-(2-iodophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCO1)c1ccccc1I |
| InChI | InChI=1S/C15H20INO/c1-2-10-17-15(14-9-5-6-11-18-14)12-7-3-4-8-13(12)16/h3-4,7-9,15,17H,2,5-6,10-11H2,1H3 |
| InChIKey | XRVQMYLRRJCTGB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|