About 2,7-diphenyl-1,4-diazepan-5-one
2,7-diphenyl-1,4-diazepan-5-one (PubChem CID 10264918) has the molecular formula C17H18N2O
and a molecular weight of 266.34 g/mol. Its IUPAC name is 2,7-diphenyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 2,7-diphenyl-1,4-diazepan-5-one |
| PubChem CID | 10264918 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2,7-diphenyl-1,4-diazepan-5-one |
| SMILES | O=C1CC(c2ccccc2)NC(c2ccccc2)CN1 |
| InChI | InChI=1S/C17H18N2O/c20-17-11-15(13-7-3-1-4-8-13)19-16(12-18-17)14-9-5-2-6-10-14/h1-10,15-16,19H,11-12H2,(H,18,20) |
| InChIKey | HXCFNDCBTPQSCI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-diphenyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diphenyl-1,4-diazepan-5-one?
The IUPAC name of 2,7-diphenyl-1,4-diazepan-5-one (CID 10264918) is 2,7-diphenyl-1,4-diazepan-5-one.
What is the SMILES notation for 2,7-diphenyl-1,4-diazepan-5-one?
The canonical SMILES for 2,7-diphenyl-1,4-diazepan-5-one is O=C1CC(c2ccccc2)NC(c2ccccc2)CN1.
What is the InChIKey of 2,7-diphenyl-1,4-diazepan-5-one?
The InChIKey is HXCFNDCBTPQSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O/c20-17-11-15(13-7-3-1-4-8-13)19-16(12-18-17)14-9-5-2-6-10-14/h1-10,15-16,19H,11-12H2,(H,18,20).
What are the key properties of 2,7-diphenyl-1,4-diazepan-5-one?
2,7-diphenyl-1,4-diazepan-5-one has a molecular weight of 266.34 g/mol, XLogP of 2.58, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diphenyl-1,4-diazepan-5-one is sourced from PubChem (CID 10264918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).