C14H27NO2 — CID 102649291
1-(3,4-dihydro-2H-pyran-6-yl)-3-propoxy-N-propylpropan-1-amine (PubChem CID 102649291) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-3-propoxy-N-propylpropan-1-amine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-3-propoxy-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 102649291 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-3-propoxy-N-propylpropan-1-amine |
| SMILES | CCCNC(CCOCCC)C1=CCCCO1 |
| InChI | InChI=1S/C14H27NO2/c1-3-9-15-13(8-12-16-10-4-2)14-7-5-6-11-17-14/h7,13,15H,3-6,8-12H2,1-2H3 |
| InChIKey | QEKOTPXYPPTOAA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|