About [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine
[cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine (PubChem CID 102649913) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine.
Molecular Properties
| Compound Name | [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine |
| PubChem CID | 102649913 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCCO1)C1CCCC1 |
| InChI | InChI=1S/C11H20N2O/c12-13-11(9-5-1-2-6-9)10-7-3-4-8-14-10/h7,9,11,13H,1-6,8,12H2 |
| InChIKey | BSXLWIBINCAIST-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine?
The IUPAC name of [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine (CID 102649913) is [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine.
What is the SMILES notation for [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine?
The canonical SMILES for [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine is NNC(C1=CCCCO1)C1CCCC1.
What is the InChIKey of [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine?
The InChIKey is BSXLWIBINCAIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c12-13-11(9-5-1-2-6-9)10-7-3-4-8-14-10/h7,9,11,13H,1-6,8,12H2.
What are the key properties of [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine?
[cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine has a molecular weight of 196.29 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methyl]hydrazine is sourced from PubChem (CID 102649913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).