About [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine
[1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine (PubChem CID 102649973) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine.
Molecular Properties
| Compound Name | [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine |
| PubChem CID | 102649973 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine |
| SMILES | CCC(C)C(NN)C1=CCCCO1 |
| InChI | InChI=1S/C10H20N2O/c1-3-8(2)10(12-11)9-6-4-5-7-13-9/h6,8,10,12H,3-5,7,11H2,1-2H3 |
| InChIKey | SJJIQODQERELBJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine?
The IUPAC name of [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine (CID 102649973) is [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine.
What is the SMILES notation for [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine?
The canonical SMILES for [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine is CCC(C)C(NN)C1=CCCCO1.
What is the InChIKey of [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine?
The InChIKey is SJJIQODQERELBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-3-8(2)10(12-11)9-6-4-5-7-13-9/h6,8,10,12H,3-5,7,11H2,1-2H3.
What are the key properties of [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine?
[1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine has a molecular weight of 184.28 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dihydro-2H-pyran-6-yl)-2-methylbutyl]hydrazine is sourced from PubChem (CID 102649973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).