About [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine
[1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine (PubChem CID 102650359) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine.
Molecular Properties
| Compound Name | [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine |
| PubChem CID | 102650359 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine |
| SMILES | NNC(CCC1CCCO1)C1=CCCCO1 |
| InChI | InChI=1S/C12H22N2O2/c13-14-11(12-5-1-2-8-16-12)7-6-10-4-3-9-15-10/h5,10-11,14H,1-4,6-9,13H2 |
| InChIKey | OEOFLELIHIRLMY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine?
The IUPAC name of [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine (CID 102650359) is [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine.
What is the SMILES notation for [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine?
The canonical SMILES for [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine is NNC(CCC1CCCO1)C1=CCCCO1.
What is the InChIKey of [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine?
The InChIKey is OEOFLELIHIRLMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c13-14-11(12-5-1-2-8-16-12)7-6-10-4-3-9-15-10/h5,10-11,14H,1-4,6-9,13H2.
What are the key properties of [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine?
[1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine has a molecular weight of 226.32 g/mol, XLogP of 1.47, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dihydro-2H-pyran-6-yl)-3-(oxolan-2-yl)propyl]hydrazine is sourced from PubChem (CID 102650359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).