About 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine
1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine (PubChem CID 102650386) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine |
| PubChem CID | 102650386 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine |
| SMILES | CCCCCC(NN)C1=CCCCO1 |
| InChI | InChI=1S/C11H22N2O/c1-2-3-4-7-10(13-12)11-8-5-6-9-14-11/h8,10,13H,2-7,9,12H2,1H3 |
| InChIKey | BDBVPWAIJBEIJP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine?
The IUPAC name of 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine (CID 102650386) is 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine?
The canonical SMILES for 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine is CCCCCC(NN)C1=CCCCO1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine?
The InChIKey is BDBVPWAIJBEIJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-2-3-4-7-10(13-12)11-8-5-6-9-14-11/h8,10,13H,2-7,9,12H2,1H3.
What are the key properties of 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine?
1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine has a molecular weight of 198.31 g/mol, XLogP of 2.09, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyran-6-yl)hexylhydrazine is sourced from PubChem (CID 102650386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).