C11H16O2 — CID 102650981
2,3-dihydrofuran-5-yl-(3-methylcyclopentyl)methanone (PubChem CID 102650981) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-(3-methylcyclopentyl)methanone.
| Compound Name | 2,3-dihydrofuran-5-yl-(3-methylcyclopentyl)methanone |
|---|---|
| PubChem CID | 102650981 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-(3-methylcyclopentyl)methanone |
| SMILES | CC1CCC(C(=O)C2=CCCO2)C1 |
| InChI | InChI=1S/C11H16O2/c1-8-4-5-9(7-8)11(12)10-3-2-6-13-10/h3,8-9H,2,4-7H2,1H3 |
| InChIKey | AEOGQKVLBFZRFH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |