About 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine
1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine (PubChem CID 102651370) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine |
| PubChem CID | 102651370 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine |
| SMILES | CNC(CCC(C)C)C1=CCCO1 |
| InChI | InChI=1S/C11H21NO/c1-9(2)6-7-10(12-3)11-5-4-8-13-11/h5,9-10,12H,4,6-8H2,1-3H3 |
| InChIKey | VGKDTFXRCUUIKV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine?
The IUPAC name of 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine (CID 102651370) is 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine.
What is the SMILES notation for 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine?
The canonical SMILES for 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine is CNC(CCC(C)C)C1=CCCO1.
What is the InChIKey of 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine?
The InChIKey is VGKDTFXRCUUIKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-9(2)6-7-10(12-3)11-5-4-8-13-11/h5,9-10,12H,4,6-8H2,1-3H3.
What are the key properties of 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine?
1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine has a molecular weight of 183.29 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydrofuran-5-yl)-N,4-dimethylpentan-1-amine is sourced from PubChem (CID 102651370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).